C14H28N4+2 — CID 12023128
(15R,16R)-1,8-dimethyl-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane (PubChem CID 12023128) has the molecular formula C14H28N4+2 and a molecular weight of 252.41 g/mol. Its IUPAC name is (15R,16R)-1,8-dimethyl-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane.
| Compound Name | (15R,16R)-1,8-dimethyl-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane |
|---|---|
| PubChem CID | 12023128 |
| Molecular Formula | C14H28N4+2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (15R,16R)-1,8-dimethyl-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane |
| SMILES | C[N+]12CCCN3CC[N+]4(C)CCCN(CC1)[C@H]4[C@H]32 |
| InChI | InChI=1S/C14H28N4/c1-17-9-3-5-15-8-12-18(2)10-4-6-16(7-11-17)14(18)13(15)17/h13-14H,3-12H2,1-2H3/q+2/t13-,14-,17?,18?/m1/s1 |
| InChIKey | NMVDIXKQBLYNIZ-JDPPGYRCSA-N |
| XLogP | -0.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|