C10H21N2+ — CID 70559144
1,4-dimethyl-2,3,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium (PubChem CID 70559144) has the molecular formula C10H21N2+ and a molecular weight of 169.29 g/mol. Its IUPAC name is 1,4-dimethyl-2,3,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium.
| Compound Name | 1,4-dimethyl-2,3,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium |
|---|---|
| PubChem CID | 70559144 |
| Molecular Formula | C10H21N2+ |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.17 |
| IUPAC Name | 1,4-dimethyl-2,3,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium |
| SMILES | CN1CC[N+]2(C)CCCCCC12 |
| InChI | InChI=1S/C10H21N2/c1-11-7-9-12(2)8-5-3-4-6-10(11)12/h10H,3-9H2,1-2H3/q+1 |
| InChIKey | DORSVEQGVLMLFV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|