C14H29N2+ — CID 91308454
1-tert-butyl-1-methyl-3,4,6,7,8,9,10,10a-octahydro-2H-pyrimido[1,2-a]azepin-1-ium (PubChem CID 91308454) has the molecular formula C14H29N2+ and a molecular weight of 225.40 g/mol. Its IUPAC name is 1-tert-butyl-1-methyl-3,4,6,7,8,9,10,10a-octahydro-2H-pyrimido[1,2-a]azepin-1-ium.
| Compound Name | 1-tert-butyl-1-methyl-3,4,6,7,8,9,10,10a-octahydro-2H-pyrimido[1,2-a]azepin-1-ium |
|---|---|
| PubChem CID | 91308454 |
| Molecular Formula | C14H29N2+ |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.23 |
| IUPAC Name | 1-tert-butyl-1-methyl-3,4,6,7,8,9,10,10a-octahydro-2H-pyrimido[1,2-a]azepin-1-ium |
| SMILES | CC(C)(C)[N+]1(C)CCCN2CCCCCC21 |
| InChI | InChI=1S/C14H29N2/c1-14(2,3)16(4)12-8-11-15-10-7-5-6-9-13(15)16/h13H,5-12H2,1-4H3/q+1 |
| InChIKey | OIRFTXSPVFSHOF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|