C9H20N3+ — CID 11601256
1,4,7-trimethyl-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-4-ium (PubChem CID 11601256) has the molecular formula C9H20N3+ and a molecular weight of 170.28 g/mol. Its IUPAC name is 1,4,7-trimethyl-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-4-ium.
| Compound Name | 1,4,7-trimethyl-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 11601256 |
| Molecular Formula | C9H20N3+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 1,4,7-trimethyl-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-4-ium |
| SMILES | CN1CC[N+]2(C)CCN(C)C2C1 |
| InChI | InChI=1S/C9H20N3/c1-10-4-6-12(3)7-5-11(2)9(12)8-10/h9H,4-8H2,1-3H3/q+1 |
| InChIKey | DTLIVALGDNYMSK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|