C12H25N3+2 — CID 21340666
1-methyl-4-(1-methylpyrrolidin-3-yl)-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 21340666) has the molecular formula C12H25N3+2 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-methyl-4-(1-methylpyrrolidin-3-yl)-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 1-methyl-4-(1-methylpyrrolidin-3-yl)-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 21340666 |
| Molecular Formula | C12H25N3+2 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-methyl-4-(1-methylpyrrolidin-3-yl)-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CN1CCC([N+]23CC[N+](C)(CC2)CC3)C1 |
| InChI | InChI=1S/C12H25N3/c1-13-4-3-12(11-13)15-8-5-14(2,6-9-15)7-10-15/h12H,3-11H2,1-2H3/q+2 |
| InChIKey | LVZHNAVILAESKO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|