C8H16N4+2 — CID 20667384
1,5-dimethyl-3,7-diaza-1,5-diazoniatetracyclo[5.2.1.03,9.05,8]decane (PubChem CID 20667384) has the molecular formula C8H16N4+2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,5-dimethyl-3,7-diaza-1,5-diazoniatetracyclo[5.2.1.03,9.05,8]decane.
| Compound Name | 1,5-dimethyl-3,7-diaza-1,5-diazoniatetracyclo[5.2.1.03,9.05,8]decane |
|---|---|
| PubChem CID | 20667384 |
| Molecular Formula | C8H16N4+2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1,5-dimethyl-3,7-diaza-1,5-diazoniatetracyclo[5.2.1.03,9.05,8]decane |
| SMILES | C[N+]12CN3C[N+]4(C)CN(C1)C4C32 |
| InChI | InChI=1S/C8H16N4/c1-11-3-9-6-12(2)4-10(5-11)8(12)7(9)11/h7-8H,3-6H2,1-2H3/q+2 |
| InChIKey | JBTCUYNJPWAZCU-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|