About 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate
1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate (PubChem CID 173061334) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate.
Molecular Properties
| Compound Name | 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate |
| PubChem CID | 173061334 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate |
| SMILES | C[N+]12CCN(CC1)CC2.O.[OH-] |
| InChI | InChI=1S/C7H15N2.2H2O/c1-9-5-2-8(3-6-9)4-7-9;;/h2-7H2,1H3;2*1H2/q+1;;/p-1 |
| InChIKey | CBNTURKNPYTYLD-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 64.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate?
The IUPAC name of 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate (CID 173061334) is 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate.
What is the SMILES notation for 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate?
The canonical SMILES for 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate is C[N+]12CCN(CC1)CC2.O.[OH-].
What is the InChIKey of 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate?
The InChIKey is CBNTURKNPYTYLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15N2.2H2O/c1-9-5-2-8(3-6-9)4-7-9;;/h2-7H2,1H3;2*1H2/q+1;;/p-1.
What are the key properties of 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate?
1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate has a molecular weight of 162.23 g/mol, XLogP of -1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;hydroxide;hydrate is sourced from PubChem (CID 173061334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).