C8H12F5N2+ — CID 144955124
1-(1,1,2,2,2-pentafluoroethyl)-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 144955124) has the molecular formula C8H12F5N2+ and a molecular weight of 231.19 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-4-aza-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-aza-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 144955124 |
| Molecular Formula | C8H12F5N2+ |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | FC(F)(F)C(F)(F)[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C8H12F5N2/c9-7(10,11)8(12,13)15-4-1-14(2-5-15)3-6-15/h1-6H2/q+1 |
| InChIKey | MGAXDMKEBSZBJQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|