C15H24F3N3O5S — CID 22457555
prop-2-enyl 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pyrrolidine-1-carboxylate;trifluoromethanesulfonate (PubChem CID 22457555) has the molecular formula C15H24F3N3O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is prop-2-enyl 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pyrrolidine-1-carboxylate;trifluoromethanesulfonate.
| Compound Name | prop-2-enyl 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pyrrolidine-1-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22457555 |
| Molecular Formula | C15H24F3N3O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | prop-2-enyl 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pyrrolidine-1-carboxylate;trifluoromethanesulfonate |
| SMILES | C=CCOC(=O)N1CCC([N+]23CCN(CC2)CC3)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H24N3O2.CHF3O3S/c1-2-11-19-14(18)16-4-3-13(12-16)17-8-5-15(6-9-17)7-10-17;2-1(3,4)8(5,6)7/h2,13H,1,3-12H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JYOKHGMUCWLLKZ-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|