About carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane
carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 160568966) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane |
| PubChem CID | 160568966 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | C[N+]12CCN(CC1)CC2.[CH3-] |
| InChI | InChI=1S/C7H15N2.CH3/c1-9-5-2-8(3-6-9)4-7-9;/h2-7H2,1H3;1H3/q+1;-1 |
| InChIKey | RAHLWTDNYXSLGR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane?
The IUPAC name of carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane (CID 160568966) is carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane.
What is the SMILES notation for carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane?
The canonical SMILES for carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane is C[N+]12CCN(CC1)CC2.[CH3-].
What is the InChIKey of carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane?
The InChIKey is RAHLWTDNYXSLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2.CH3/c1-9-5-2-8(3-6-9)4-7-9;/h2-7H2,1H3;1H3/q+1;-1.
What are the key properties of carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane?
carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane has a molecular weight of 142.25 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane is sourced from PubChem (CID 160568966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).