C9H15NO2 — CID 102386172
(3S,5R)-1-oxido-1-azoniatricyclo[3.3.1.13,7]decan-4-ol (PubChem CID 102386172) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3S,5R)-1-oxido-1-azoniatricyclo[3.3.1.13,7]decan-4-ol.
| Compound Name | (3S,5R)-1-oxido-1-azoniatricyclo[3.3.1.13,7]decan-4-ol |
|---|---|
| PubChem CID | 102386172 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3S,5R)-1-oxido-1-azoniatricyclo[3.3.1.13,7]decan-4-ol |
| SMILES | [O-][N+]12CC3C[C@H](C1)C(O)[C@@H](C3)C2 |
| InChI | InChI=1S/C9H15NO2/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9,11H,1-5H2/t6?,7-,8+,9?,10? |
| InChIKey | NTDXJMCPURLXNN-ALPUWHEMSA-N |
| XLogP | 0.33 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|