C10H17N3O3 — CID 106148591
N-(cyanomethyl)-N'-(4-hydroxy-2,2-dimethylbutyl)oxamide (PubChem CID 106148591) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(4-hydroxy-2,2-dimethylbutyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(4-hydroxy-2,2-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 106148591 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(cyanomethyl)-N'-(4-hydroxy-2,2-dimethylbutyl)oxamide |
| SMILES | CC(C)(CCO)CNC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C10H17N3O3/c1-10(2,3-6-14)7-13-9(16)8(15)12-5-4-11/h14H,3,5-7H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | MTWOLHGLJRZADQ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|