C11H19N3O2 — CID 65043672
N-(cyanomethyl)-N'-(3-ethylpentan-3-yl)oxamide (PubChem CID 65043672) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(3-ethylpentan-3-yl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(3-ethylpentan-3-yl)oxamide |
|---|---|
| PubChem CID | 65043672 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(cyanomethyl)-N'-(3-ethylpentan-3-yl)oxamide |
| SMILES | CCC(CC)(CC)NC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C11H19N3O2/c1-4-11(5-2,6-3)14-10(16)9(15)13-8-7-12/h4-6,8H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | OTASDYXCQRLXPB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|