C9H13N3O2 — CID 106188852
N'-(cyanomethyl)-N-(3-methylbut-2-enyl)oxamide (PubChem CID 106188852) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N'-(cyanomethyl)-N-(3-methylbut-2-enyl)oxamide.
| Compound Name | N'-(cyanomethyl)-N-(3-methylbut-2-enyl)oxamide |
|---|---|
| PubChem CID | 106188852 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N'-(cyanomethyl)-N-(3-methylbut-2-enyl)oxamide |
| SMILES | CC(C)=CCNC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C9H13N3O2/c1-7(2)3-5-11-8(13)9(14)12-6-4-10/h3H,5-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | ISRUSQROOWTMMB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|