C15H18O6S — CID 10616110
(1S,2R,6R,7R)-7-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane (PubChem CID 10616110) has the molecular formula C15H18O6S and a molecular weight of 326.37 g/mol. Its IUPAC name is (1S,2R,6R,7R)-7-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6R,7R)-7-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 10616110 |
| Molecular Formula | C15H18O6S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (1S,2R,6R,7R)-7-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane |
| SMILES | CC1(C)O[C@@H]2[C@@H]3CO[C@@](CS(=O)(=O)c4ccccc4)(O3)[C@@H]2O1 |
| InChI | InChI=1S/C15H18O6S/c1-14(2)20-12-11-8-18-15(19-11,13(12)21-14)9-22(16,17)10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12+,13+,15-/m0/s1 |
| InChIKey | QKDOANUMQFCZGE-JLNYLFASSA-N |
| XLogP | 1.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |