C11H15F2NO4 — CID 106167931
(1S,6R)-6-[(2,2-difluoro-3-hydroxypropyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 106167931) has the molecular formula C11H15F2NO4 and a molecular weight of 263.24 g/mol. Its IUPAC name is (1S,6R)-6-[(2,2-difluoro-3-hydroxypropyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(2,2-difluoro-3-hydroxypropyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 106167931 |
| Molecular Formula | C11H15F2NO4 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1S,6R)-6-[(2,2-difluoro-3-hydroxypropyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H15F2NO4/c12-11(13,6-15)5-14-9(16)7-3-1-2-4-8(7)10(17)18/h1-2,7-8,15H,3-6H2,(H,14,16)(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | GHVQVZYHJPUKFT-SFYZADRCSA-N |
| XLogP | 0.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|