C10H17BrF3NO — CID 106169663
N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutanamide (PubChem CID 106169663) has the molecular formula C10H17BrF3NO and a molecular weight of 304.15 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 106169663 |
| Molecular Formula | C10H17BrF3NO |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutanamide |
| SMILES | CCC(C)(CCBr)NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H17BrF3NO/c1-3-9(2,6-7-11)15-8(16)4-5-10(12,13)14/h3-7H2,1-2H3,(H,15,16) |
| InChIKey | BHKJTVIISYPNHK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|