C13H18Br2O2 — CID 10618876
(5R)-5-(2,2-dibromoethenyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane (PubChem CID 10618876) has the molecular formula C13H18Br2O2 and a molecular weight of 366.09 g/mol. Its IUPAC name is (5R)-5-(2,2-dibromoethenyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane.
| Compound Name | (5R)-5-(2,2-dibromoethenyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10618876 |
| Molecular Formula | C13H18Br2O2 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | (5R)-5-(2,2-dibromoethenyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane |
| SMILES | C=CCC1(CC=C)OC(C)(C)O[C@@H]1C=C(Br)Br |
| InChI | InChI=1S/C13H18Br2O2/c1-5-7-13(8-6-2)10(9-11(14)15)16-12(3,4)17-13/h5-6,9-10H,1-2,7-8H2,3-4H3/t10-/m1/s1 |
| InChIKey | KEXITXCMWQGFNG-SNVBAGLBSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|