About 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one
4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one (PubChem CID 106189407) has the molecular formula C13H15BrN2O2
and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one |
| PubChem CID | 106189407 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one |
| SMILES | O=C1CC(NCC2Cc3cc(Br)ccc3O2)CN1 |
| InChI | InChI=1S/C13H15BrN2O2/c14-9-1-2-12-8(3-9)4-11(18-12)7-15-10-5-13(17)16-6-10/h1-3,10-11,15H,4-7H2,(H,16,17) |
| InChIKey | YWIGRYNRKUNTFM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one?
The IUPAC name of 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one (CID 106189407) is 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one.
What is the SMILES notation for 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one?
The canonical SMILES for 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one is O=C1CC(NCC2Cc3cc(Br)ccc3O2)CN1.
What is the InChIKey of 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one?
The InChIKey is YWIGRYNRKUNTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O2/c14-9-1-2-12-8(3-9)4-11(18-12)7-15-10-5-13(17)16-6-10/h1-3,10-11,15H,4-7H2,(H,16,17).
What are the key properties of 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one?
4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one has a molecular weight of 311.18 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]pyrrolidin-2-one is sourced from PubChem (CID 106189407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).