C18H32N4O7 — CID 10621832
methyl 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoylamino]propanoate (PubChem CID 10621832) has the molecular formula C18H32N4O7 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoylamino]propanoate.
| Compound Name | methyl 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 10621832 |
| Molecular Formula | C18H32N4O7 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | methyl 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)CCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N4O7/c1-17(2,3)28-15(25)21-14(22-16(26)29-18(4,5)6)20-10-8-12(23)19-11-9-13(24)27-7/h8-11H2,1-7H3,(H,19,23)(H2,20,21,22,25,26) |
| InChIKey | GXWZBODIOWHMQE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|