C20H39N5O5 — CID 10598690
tert-butyl N-[N'-[6-(3-aminopropanoylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 10598690) has the molecular formula C20H39N5O5 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl N-[N'-[6-(3-aminopropanoylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[6-(3-aminopropanoylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 10598690 |
| Molecular Formula | C20H39N5O5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | tert-butyl N-[N'-[6-(3-aminopropanoylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)CCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39N5O5/c1-19(2,3)29-17(27)24-16(25-18(28)30-20(4,5)6)23-14-10-8-7-9-13-22-15(26)11-12-21/h7-14,21H2,1-6H3,(H,22,26)(H2,23,24,25,27,28) |
| InChIKey | GETFKERXZMVUAC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|