C15H19ClN2O3 — CID 106224178
1-[3-(2-chloro-3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butan-1-amine (PubChem CID 106224178) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 1-[3-(2-chloro-3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butan-1-amine.
| Compound Name | 1-[3-(2-chloro-3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butan-1-amine |
|---|---|
| PubChem CID | 106224178 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[3-(2-chloro-3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butan-1-amine |
| SMILES | CCCC(N)c1cc(-c2ccc(OC)c(OC)c2Cl)no1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-4-5-10(17)13-8-11(18-21-13)9-6-7-12(19-2)15(20-3)14(9)16/h6-8,10H,4-5,17H2,1-3H3 |
| InChIKey | WKWAKAQVOOUBPD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |