C29H23NO6 — CID 10624592
22-benzyl-5,8-dihydroxy-12-methoxy-22-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1,4,6,8,11,13,15(20)-heptaene-3,10,21-trione (PubChem CID 10624592) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is 22-benzyl-5,8-dihydroxy-12-methoxy-22-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1,4,6,8,11,13,15(20)-heptaene-3,10,21-trione.
| Compound Name | 22-benzyl-5,8-dihydroxy-12-methoxy-22-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1,4,6,8,11,13,15(20)-heptaene-3,10,21-trione |
|---|---|
| PubChem CID | 10624592 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 22-benzyl-5,8-dihydroxy-12-methoxy-22-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1,4,6,8,11,13,15(20)-heptaene-3,10,21-trione |
| SMILES | COc1cc2c3c(c(=O)n(Cc4ccccc4)c2c2c1C(=O)c1c(O)ccc(O)c1C2=O)CCCC3 |
| InChI | InChI=1S/C29H23NO6/c1-36-21-13-18-16-9-5-6-10-17(16)29(35)30(14-15-7-3-2-4-8-15)26(18)25-24(21)27(33)22-19(31)11-12-20(32)23(22)28(25)34/h2-4,7-8,11-13,31-32H,5-6,9-10,14H2,1H3 |
| InChIKey | HQPMMOSNLRKERV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|