C22H21NO5 — CID 70560382
4-benzyl-5,7-dimethoxy-6-methyl-3-oxo-1,2-dihydrocyclopenta[b]indole-2-carboxylic acid (PubChem CID 70560382) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-benzyl-5,7-dimethoxy-6-methyl-3-oxo-1,2-dihydrocyclopenta[b]indole-2-carboxylic acid.
| Compound Name | 4-benzyl-5,7-dimethoxy-6-methyl-3-oxo-1,2-dihydrocyclopenta[b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 70560382 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-benzyl-5,7-dimethoxy-6-methyl-3-oxo-1,2-dihydrocyclopenta[b]indole-2-carboxylic acid |
| SMILES | COc1cc2c3c(n(Cc4ccccc4)c2c(OC)c1C)C(=O)C(C(=O)O)C3 |
| InChI | InChI=1S/C22H21NO5/c1-12-17(27-2)10-15-14-9-16(22(25)26)20(24)18(14)23(19(15)21(12)28-3)11-13-7-5-4-6-8-13/h4-8,10,16H,9,11H2,1-3H3,(H,25,26) |
| InChIKey | YVUDOKIVFBYWRF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|