C22H25IN2O3 — CID 10624960
ethyl (4R,6R)-3-benzhydryl-6-(iodomethyl)-4-methyl-2-oxo-1,3-diazinane-1-carboxylate (PubChem CID 10624960) has the molecular formula C22H25IN2O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is ethyl (4R,6R)-3-benzhydryl-6-(iodomethyl)-4-methyl-2-oxo-1,3-diazinane-1-carboxylate.
| Compound Name | ethyl (4R,6R)-3-benzhydryl-6-(iodomethyl)-4-methyl-2-oxo-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 10624960 |
| Molecular Formula | C22H25IN2O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | ethyl (4R,6R)-3-benzhydryl-6-(iodomethyl)-4-methyl-2-oxo-1,3-diazinane-1-carboxylate |
| SMILES | CCOC(=O)N1C(=O)N(C(c2ccccc2)c2ccccc2)[C@H](C)C[C@@H]1CI |
| InChI | InChI=1S/C22H25IN2O3/c1-3-28-22(27)25-19(15-23)14-16(2)24(21(25)26)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19-20H,3,14-15H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | MENSRMBTEFNPNC-VQIMIIECSA-N |
| XLogP | 5.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|