C31H30ClN3O4 — CID 10626348
(E)-N-[(4R,4aS,7aR,12bR)-9-(cyanomethoxy)-3-(cyclopropylmethyl)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 10626348) has the molecular formula C31H30ClN3O4 and a molecular weight of 544.05 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,7aR,12bR)-9-(cyanomethoxy)-3-(cyclopropylmethyl)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,7aR,12bR)-9-(cyanomethoxy)-3-(cyclopropylmethyl)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 10626348 |
| Molecular Formula | C31H30ClN3O4 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (E)-N-[(4R,4aS,7aR,12bR)-9-(cyanomethoxy)-3-(cyclopropylmethyl)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | N#CCOc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(NC(=O)/C=C/c5ccc(Cl)cc5)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C31H30ClN3O4/c32-22-7-3-19(4-8-22)5-10-26(37)34-31-12-11-23(36)29-30(31)13-15-35(18-20-1-2-20)25(31)17-21-6-9-24(38-16-14-33)28(39-29)27(21)30/h3-10,20,25,29H,1-2,11-13,15-18H2,(H,34,37)/b10-5+/t25-,29+,30+,31-/m1/s1 |
| InChIKey | ZBEAPJFBGFTEGP-XHHGYVPCSA-N |
| XLogP | 4.21 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|