C33H29ClN2O4 — CID 10626552
methyl (4S)-1-benzyl-5-[(1S)-2-chloro-1-hydroxyethyl]-2-oxo-3-(9-phenylfluoren-9-yl)imidazolidine-4-carboxylate (PubChem CID 10626552) has the molecular formula C33H29ClN2O4 and a molecular weight of 553.06 g/mol. Its IUPAC name is methyl (4S)-1-benzyl-5-[(1S)-2-chloro-1-hydroxyethyl]-2-oxo-3-(9-phenylfluoren-9-yl)imidazolidine-4-carboxylate.
| Compound Name | methyl (4S)-1-benzyl-5-[(1S)-2-chloro-1-hydroxyethyl]-2-oxo-3-(9-phenylfluoren-9-yl)imidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10626552 |
| Molecular Formula | C33H29ClN2O4 |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | methyl (4S)-1-benzyl-5-[(1S)-2-chloro-1-hydroxyethyl]-2-oxo-3-(9-phenylfluoren-9-yl)imidazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C([C@H](O)CCl)N(Cc2ccccc2)C(=O)N1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H29ClN2O4/c1-40-31(38)30-29(28(37)20-34)35(21-22-12-4-2-5-13-22)32(39)36(30)33(23-14-6-3-7-15-23)26-18-10-8-16-24(26)25-17-9-11-19-27(25)33/h2-19,28-30,37H,20-21H2,1H3/t28-,29?,30+/m1/s1 |
| InChIKey | DCCQJUPZUGSPAC-MILORHPOSA-N |
| XLogP | 5.41 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|