C11H18N4 — CID 106282242
N-(cyclohex-3-en-1-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 106282242) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106282242 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CC(NCC1CC=CCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H18N4/c1-9(11-13-8-14-15-11)12-7-10-5-3-2-4-6-10/h2-3,8-10,12H,4-7H2,1H3,(H,13,14,15) |
| InChIKey | LQIMZCWULKMXDT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|