C11H23F3N2O2S — CID 106286679
N-(2-amino-3-ethylpentyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106286679) has the molecular formula C11H23F3N2O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-(2-amino-3-ethylpentyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(2-amino-3-ethylpentyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106286679 |
| Molecular Formula | C11H23F3N2O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(2-amino-3-ethylpentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCC(CC)C(N)CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H23F3N2O2S/c1-3-9(4-2)10(15)8-16-19(17,18)7-5-6-11(12,13)14/h9-10,16H,3-8,15H2,1-2H3 |
| InChIKey | LHXNKUGDSSXFDT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |