C10H9NO2 — CID 10631084
6-methyl-4H-1,4-benzoxazine-2-carbaldehyde (PubChem CID 10631084) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 6-methyl-4H-1,4-benzoxazine-2-carbaldehyde.
| Compound Name | 6-methyl-4H-1,4-benzoxazine-2-carbaldehyde |
|---|---|
| PubChem CID | 10631084 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 6-methyl-4H-1,4-benzoxazine-2-carbaldehyde |
| SMILES | Cc1ccc2c(c1)NC=C(C=O)O2 |
| InChI | InChI=1S/C10H9NO2/c1-7-2-3-10-9(4-7)11-5-8(6-12)13-10/h2-6,11H,1H3 |
| InChIKey | XDBKVAUBOHYDCN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|