C17H24O3 — CID 10636199
(1'S,2'R,6'S,7'R)-4'-tert-butyl-7'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10636199) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1'S,2'R,6'S,7'R)-4'-tert-butyl-7'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'S,2'R,6'S,7'R)-4'-tert-butyl-7'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10636199 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1'S,2'R,6'S,7'R)-4'-tert-butyl-7'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | CC(C)(C)C1=C[C@H]2[C@@H](C1=O)[C@@H]1C3(CC[C@@]12C)OCCO3 |
| InChI | InChI=1S/C17H24O3/c1-15(2,3)11-9-10-12(13(11)18)14-16(10,4)5-6-17(14)19-7-8-20-17/h9-10,12,14H,5-8H2,1-4H3/t10-,12-,14-,16+/m0/s1 |
| InChIKey | OSCBPPIAMBMXQR-YLUJIRGKSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |