C14H16N4OS — CID 106369399
5-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 106369399) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 5-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 106369399 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | CCc1cnc(CNc2cc3nc(C)sc3cc2N)o1 |
| InChI | InChI=1S/C14H16N4OS/c1-3-9-6-17-14(19-9)7-16-11-5-12-13(4-10(11)15)20-8(2)18-12/h4-6,16H,3,7,15H2,1-2H3 |
| InChIKey | IFBKPJRXLLDJSV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|