C7H13N5O — CID 106373236
1-amino-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine (PubChem CID 106373236) has the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-amino-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine.
| Compound Name | 1-amino-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 106373236 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1-amino-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine |
| SMILES | Cc1nc(C/N=C(\N)NN)oc1C |
| InChI | InChI=1S/C7H13N5O/c1-4-5(2)13-6(11-4)3-10-7(8)12-9/h3,9H2,1-2H3,(H3,8,10,12) |
| InChIKey | WMNPGZSQVOCVPI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|