C17H32O3Si — CID 10638888
(5aS,9R,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-5a-methyl-1,4,5,6,7,8,9,9a-octahydrobenzo[c]oxepin-3-one (PubChem CID 10638888) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (5aS,9R,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-5a-methyl-1,4,5,6,7,8,9,9a-octahydrobenzo[c]oxepin-3-one.
| Compound Name | (5aS,9R,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-5a-methyl-1,4,5,6,7,8,9,9a-octahydrobenzo[c]oxepin-3-one |
|---|---|
| PubChem CID | 10638888 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (5aS,9R,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-5a-methyl-1,4,5,6,7,8,9,9a-octahydrobenzo[c]oxepin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@@]2(C)CCC(=O)OC[C@H]12 |
| InChI | InChI=1S/C17H32O3Si/c1-16(2,3)21(5,6)20-14-8-7-10-17(4)11-9-15(18)19-12-13(14)17/h13-14H,7-12H2,1-6H3/t13-,14-,17+/m1/s1 |
| InChIKey | XZPMWQHKAGYXCG-CPUCHLNUSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|