C12H12N2O4S2 — CID 106435996
2-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 106435996) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 106435996 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(NCC(O)c1ccsc1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C12H12N2O4S2/c15-9(7-1-3-19-6-7)5-13-12(18)14-10-8(11(16)17)2-4-20-10/h1-4,6,9,15H,5H2,(H,16,17)(H2,13,14,18) |
| InChIKey | BDIOXQJVWOVPEP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |