C22H37NO3Si — CID 10644193
tert-butyl N-[(3S,4S,5R)-5-[dimethyl(phenyl)silyl]-5-hydroxy-3-methyloct-7-en-4-yl]carbamate (PubChem CID 10644193) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S,5R)-5-[dimethyl(phenyl)silyl]-5-hydroxy-3-methyloct-7-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S,5R)-5-[dimethyl(phenyl)silyl]-5-hydroxy-3-methyloct-7-en-4-yl]carbamate |
|---|---|
| PubChem CID | 10644193 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl N-[(3S,4S,5R)-5-[dimethyl(phenyl)silyl]-5-hydroxy-3-methyloct-7-en-4-yl]carbamate |
| SMILES | C=CC[C@](O)([C@@H](NC(=O)OC(C)(C)C)[C@@H](C)CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO3Si/c1-9-16-22(25,27(7,8)18-14-12-11-13-15-18)19(17(3)10-2)23-20(24)26-21(4,5)6/h9,11-15,17,19,25H,1,10,16H2,2-8H3,(H,23,24)/t17-,19-,22+/m0/s1 |
| InChIKey | KDGDBUGKEZECKX-LQBOVUBWSA-N |
| XLogP | 4.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|