C13H10BrF7O — CID 10644377
(E)-1-(2-bromophenyl)-4,4,5,5,6,6,6-heptafluoro-2-methylhex-1-en-3-ol (PubChem CID 10644377) has the molecular formula C13H10BrF7O and a molecular weight of 395.11 g/mol. Its IUPAC name is (E)-1-(2-bromophenyl)-4,4,5,5,6,6,6-heptafluoro-2-methylhex-1-en-3-ol.
| Compound Name | (E)-1-(2-bromophenyl)-4,4,5,5,6,6,6-heptafluoro-2-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 10644377 |
| Molecular Formula | C13H10BrF7O |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | (E)-1-(2-bromophenyl)-4,4,5,5,6,6,6-heptafluoro-2-methylhex-1-en-3-ol |
| SMILES | C/C(=C\c1ccccc1Br)C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10BrF7O/c1-7(6-8-4-2-3-5-9(8)14)10(22)11(15,16)12(17,18)13(19,20)21/h2-6,10,22H,1H3/b7-6+ |
| InChIKey | DZJFHTDBAVYDIO-VOTSOKGWSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|