About 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene
1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene (PubChem CID 145082215) has the molecular formula C12H13Br
and a molecular weight of 237.14 g/mol. Its IUPAC name is 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene |
| PubChem CID | 145082215 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene |
| SMILES | C=C(C)C(C)=Cc1ccccc1Br |
| InChI | InChI=1S/C12H13Br/c1-9(2)10(3)8-11-6-4-5-7-12(11)13/h4-8H,1H2,2-3H3 |
| InChIKey | GQAWWGRNFXBHNY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene?
The IUPAC name of 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene (CID 145082215) is 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene.
What is the SMILES notation for 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene?
The canonical SMILES for 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene is C=C(C)C(C)=Cc1ccccc1Br.
What is the InChIKey of 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene?
The InChIKey is GQAWWGRNFXBHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br/c1-9(2)10(3)8-11-6-4-5-7-12(11)13/h4-8H,1H2,2-3H3.
What are the key properties of 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene?
1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene has a molecular weight of 237.14 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2,3-dimethylbuta-1,3-dienyl)benzene is sourced from PubChem (CID 145082215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).