C21H22ClN3O4S — CID 10647124
1-(3-chloroanilino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methyl-5-phenylimidazole-2-thione (PubChem CID 10647124) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is 1-(3-chloroanilino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methyl-5-phenylimidazole-2-thione.
| Compound Name | 1-(3-chloroanilino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methyl-5-phenylimidazole-2-thione |
|---|---|
| PubChem CID | 10647124 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 1-(3-chloroanilino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methyl-5-phenylimidazole-2-thione |
| SMILES | Cc1c(-c2ccccc2)n(Nc2cccc(Cl)c2)c(=S)n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22ClN3O4S/c1-12-17(13-6-3-2-4-7-13)25(23-15-9-5-8-14(22)10-15)21(30)24(12)20-19(28)18(27)16(11-26)29-20/h2-10,16,18-20,23,26-28H,11H2,1H3/t16-,18-,19-,20-/m1/s1 |
| InChIKey | DEPWAZKPUDYLNJ-VBSBHUPXSA-N |
| XLogP | 3.13 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|