C12H17BrN2S3 — CID 106480012
5-bromo-2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106480012) has the molecular formula C12H17BrN2S3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-bromo-2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480012 |
| Molecular Formula | C12H17BrN2S3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-bromo-2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(C2SCCSC2C)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrN2S3/c1-6(2)9-8(13)12(16)15-11(14-9)10-7(3)17-4-5-18-10/h6-7,10H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | LFOLIOMCMQUTSC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|