C12H16BrN3S2 — CID 106480276
5-bromo-6-cyclopropyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106480276) has the molecular formula C12H16BrN3S2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480276 |
| Molecular Formula | C12H16BrN3S2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
| SMILES | CN1CCSCC1c1nc(=S)c(Br)c(C2CC2)[nH]1 |
| InChI | InChI=1S/C12H16BrN3S2/c1-16-4-5-18-6-8(16)11-14-10(7-2-3-7)9(13)12(17)15-11/h7-8H,2-6H2,1H3,(H,14,15,17) |
| InChIKey | OWWCAGUDSWGZLB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|