C13H20BrN3S2 — CID 106481056
5-bromo-6-(2-methylpropyl)-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106481056) has the molecular formula C13H20BrN3S2 and a molecular weight of 362.36 g/mol. Its IUPAC name is 5-bromo-6-(2-methylpropyl)-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(2-methylpropyl)-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481056 |
| Molecular Formula | C13H20BrN3S2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 5-bromo-6-(2-methylpropyl)-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(C2CSCCN2C)nc(=S)c1Br |
| InChI | InChI=1S/C13H20BrN3S2/c1-8(2)6-9-11(14)13(18)16-12(15-9)10-7-19-5-4-17(10)3/h8,10H,4-7H2,1-3H3,(H,15,16,18) |
| InChIKey | PZZXKGIVTNSXQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|