C12H17BrN2S3 — CID 106481257
5-bromo-2-(1,4-dithian-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 106481257) has the molecular formula C12H17BrN2S3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dithian-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(1,4-dithian-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481257 |
| Molecular Formula | C12H17BrN2S3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-bromo-2-(1,4-dithian-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(C2CSCCS2)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrN2S3/c1-7(2)5-8-10(13)12(16)15-11(14-8)9-6-17-3-4-18-9/h7,9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | UVAQGDJYLQSKHU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|