C15H23BrN4S — CID 106482119
5-bromo-6-cyclopentyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106482119) has the molecular formula C15H23BrN4S and a molecular weight of 371.35 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482119 |
| Molecular Formula | C15H23BrN4S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CN1CCN(C)C(c2nc(=S)c(Br)c(C3CCCC3)[nH]2)C1 |
| InChI | InChI=1S/C15H23BrN4S/c1-19-7-8-20(2)11(9-19)14-17-13(10-5-3-4-6-10)12(16)15(21)18-14/h10-11H,3-9H2,1-2H3,(H,17,18,21) |
| InChIKey | HHKSCHCISYJHNN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|