C28H30N2O6 — CID 10648767
methyl (2R,3S)-3-[(2S,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-3-(4-methoxyanilino)-2-phenylmethoxypropanoate (PubChem CID 10648767) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is methyl (2R,3S)-3-[(2S,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-3-(4-methoxyanilino)-2-phenylmethoxypropanoate.
| Compound Name | methyl (2R,3S)-3-[(2S,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-3-(4-methoxyanilino)-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 10648767 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | methyl (2R,3S)-3-[(2S,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-3-(4-methoxyanilino)-2-phenylmethoxypropanoate |
| SMILES | COC(=O)[C@H](OCc1ccccc1)[C@@H](Nc1ccc(OC)cc1)[C@H]1[C@@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H30N2O6/c1-34-22-15-13-21(14-16-22)29-23(26(28(33)35-2)36-18-20-11-7-4-8-12-20)24-25(31)27(32)30(24)17-19-9-5-3-6-10-19/h3-16,23-26,29,31H,17-18H2,1-2H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | JKMCKAWESRXHLB-QEGGNFSNSA-N |
| XLogP | 3.01 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|