C10H12F2N2O4 — CID 106492708
3-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]-1-methylpyrrolidine-2,5-dione (PubChem CID 106492708) has the molecular formula C10H12F2N2O4 and a molecular weight of 262.21 g/mol. Its IUPAC name is 3-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106492708 |
| Molecular Formula | C10H12F2N2O4 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(NCC2CC(F)(F)C(=O)O2)C1=O |
| InChI | InChI=1S/C10H12F2N2O4/c1-14-7(15)2-6(8(14)16)13-4-5-3-10(11,12)9(17)18-5/h5-6,13H,2-4H2,1H3 |
| InChIKey | UVXFWKQFNRZAFD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|