C14H20N2O2S — CID 106505461
3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,4,5-trimethylaniline (PubChem CID 106505461) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,4,5-trimethylaniline.
| Compound Name | 3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,4,5-trimethylaniline |
|---|---|
| PubChem CID | 106505461 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,4,5-trimethylaniline |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)N2CC=CCC2)c1C |
| InChI | InChI=1S/C14H20N2O2S/c1-10-9-13(15)12(3)14(11(10)2)19(17,18)16-7-5-4-6-8-16/h4-5,9H,6-8,15H2,1-3H3 |
| InChIKey | JFOBUORBKAITEH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|