C30H44N8O2 — CID 10650959
5-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 10650959) has the molecular formula C30H44N8O2 and a molecular weight of 548.74 g/mol. Its IUPAC name is 5-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | 5-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 10650959 |
| Molecular Formula | C30H44N8O2 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | 5-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCCCC(C#N)(c3ccc(OC)c(OC)c3)C(C)C)CC2)n1 |
| InChI | InChI=1S/C30H44N8O2/c1-7-15-33-27-35-28(34-16-8-2)37-29(36-27)38-18-12-24(13-19-38)32-17-9-14-30(21-31,22(3)4)23-10-11-25(39-5)26(20-23)40-6/h7-8,10-11,20,22,24,32H,1-2,9,12-19H2,3-6H3,(H2,33,34,35,36,37) |
| InChIKey | OACFJGMVFCPRHB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|