C17H15N3S — CID 106519697
2-cyclopropyl-5-methyl-6-quinolin-8-yl-1H-pyrimidine-4-thione (PubChem CID 106519697) has the molecular formula C17H15N3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-cyclopropyl-5-methyl-6-quinolin-8-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-cyclopropyl-5-methyl-6-quinolin-8-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106519697 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-cyclopropyl-5-methyl-6-quinolin-8-yl-1H-pyrimidine-4-thione |
| SMILES | Cc1c(-c2cccc3cccnc23)[nH]c(C2CC2)nc1=S |
| InChI | InChI=1S/C17H15N3S/c1-10-14(19-16(12-7-8-12)20-17(10)21)13-6-2-4-11-5-3-9-18-15(11)13/h2-6,9,12H,7-8H2,1H3,(H,19,20,21) |
| InChIKey | RNLJICLHCKVYEJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|