C9H14N4OS — CID 106526291
2-[[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 106526291) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 106526291 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | CN(C)CCc1noc(CSCC#N)n1 |
| InChI | InChI=1S/C9H14N4OS/c1-13(2)5-3-8-11-9(14-12-8)7-15-6-4-10/h3,5-7H2,1-2H3 |
| InChIKey | VCVROMWLCGSPBZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|